2-butoxyethanol

  C6H14O2/CH3(CH2)2CH2OCH2CH2OH

   CAS No: 111-76-2

is a neurotoxin, pesticide, poison, solvent & a teratogen

Why don't you look in that direction?
 

http://www.valdezlink.com/gwv/reply-texas-allocation.htm#dear

 

Is there a group of gulf war vets who want to be in a trial with FREE Glyconutrients?

http://www.valdezlink.com/pages/glyconutrient-intro.htm  Dr REG expressed interest in providing them for a study

The proof of 2-butoxyethanol harm is the FATIGUE of CFIDS

IMHA  Immune Mediated Hemolytic Anemia

*

This should apply to current troops, civilians, 'gulf war syndrome' vets, Korean Vets, Vietnam Vets, WWII vets, WWI vets

 

Check these things first ... signs of EGBE exposure